C16H21BN2O2S — CID 170804044
3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170804044) has the molecular formula C16H21BN2O2S and a molecular weight of 316.24 g/mol. Its IUPAC name is 3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170804044 |
| Molecular Formula | C16H21BN2O2S |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2ccnc3[nH]ccc23)CS)OC1(C)C |
| InChI | InChI=1S/C16H21BN2O2S/c1-15(2)16(3,4)21-17(20-15)12(10-22)9-11-5-7-18-14-13(11)6-8-19-14/h5-9,22H,10H2,1-4H3,(H,18,19) |
| InChIKey | CWEDVVTUTXFUMI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|