C18H21BClNO3S — CID 170804072
5-chloro-7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]quinolin-8-ol (PubChem CID 170804072) has the molecular formula C18H21BClNO3S and a molecular weight of 377.70 g/mol. Its IUPAC name is 5-chloro-7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]quinolin-8-ol.
| Compound Name | 5-chloro-7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]quinolin-8-ol |
|---|---|
| PubChem CID | 170804072 |
| Molecular Formula | C18H21BClNO3S |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 5-chloro-7-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]quinolin-8-ol |
| SMILES | CC1(C)OB(C(=Cc2cc(Cl)c3cccnc3c2O)CS)OC1(C)C |
| InChI | InChI=1S/C18H21BClNO3S/c1-17(2)18(3,4)24-19(23-17)12(10-25)8-11-9-14(20)13-6-5-7-21-15(13)16(11)22/h5-9,22,25H,10H2,1-4H3 |
| InChIKey | JUIYEJUHJWZTDH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|