C18H22BNO2S — CID 170803283
3-isoquinolin-8-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803283) has the molecular formula C18H22BNO2S and a molecular weight of 327.26 g/mol. Its IUPAC name is 3-isoquinolin-8-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-isoquinolin-8-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803283 |
| Molecular Formula | C18H22BNO2S |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-isoquinolin-8-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cccc3ccncc23)CS)OC1(C)C |
| InChI | InChI=1S/C18H22BNO2S/c1-17(2)18(3,4)22-19(21-17)15(12-23)10-14-7-5-6-13-8-9-20-11-16(13)14/h5-11,23H,12H2,1-4H3 |
| InChIKey | GEDMWIPLWPUAGF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|