About 7H-cyclopenta[b]pyridine;ethane
7H-cyclopenta[b]pyridine;ethane (PubChem CID 91481517) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 7H-cyclopenta[b]pyridine;ethane.
Molecular Properties
| Compound Name | 7H-cyclopenta[b]pyridine;ethane |
| PubChem CID | 91481517 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 7H-cyclopenta[b]pyridine;ethane |
| SMILES | C1=Cc2cccnc2C1.CC |
| InChI | InChI=1S/C8H7N.C2H6/c1-3-7-4-2-6-9-8(7)5-1;1-2/h1-4,6H,5H2;1-2H3 |
| InChIKey | XJRAXEVYURBHOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7H-cyclopenta[b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-cyclopenta[b]pyridine;ethane?
The IUPAC name of 7H-cyclopenta[b]pyridine;ethane (CID 91481517) is 7H-cyclopenta[b]pyridine;ethane.
What is the SMILES notation for 7H-cyclopenta[b]pyridine;ethane?
The canonical SMILES for 7H-cyclopenta[b]pyridine;ethane is C1=Cc2cccnc2C1.CC.
What is the InChIKey of 7H-cyclopenta[b]pyridine;ethane?
The InChIKey is XJRAXEVYURBHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C2H6/c1-3-7-4-2-6-9-8(7)5-1;1-2/h1-4,6H,5H2;1-2H3.
What are the key properties of 7H-cyclopenta[b]pyridine;ethane?
7H-cyclopenta[b]pyridine;ethane has a molecular weight of 147.22 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-cyclopenta[b]pyridine;ethane is sourced from PubChem (CID 91481517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).