About ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine
ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 90875415) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
Analyze ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 90875415) is ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine is CC.CC.CC.CC1Cc2cccnc2C1.
What is the InChIKey of ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is KMAJUCLSYRNURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.3C2H6/c1-7-5-8-3-2-4-10-9(8)6-7;3*1-2/h2-4,7H,5-6H2,1H3;3*1-2H3.
What are the key properties of ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 223.40 g/mol, XLogP of 4.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 90875415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).