C8H9N3 — CID 143529753
4H-1,5-naphthyridin-1-amine (PubChem CID 143529753) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 4H-1,5-naphthyridin-1-amine.
| Compound Name | 4H-1,5-naphthyridin-1-amine |
|---|---|
| PubChem CID | 143529753 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4H-1,5-naphthyridin-1-amine |
| SMILES | NN1C=CCc2ncccc21 |
| InChI | InChI=1S/C8H9N3/c9-11-6-2-3-7-8(11)4-1-5-10-7/h1-2,4-6H,3,9H2 |
| InChIKey | ZDJZKHPFPHGLOL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|