C12H11N3 — CID 139666855
1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine (PubChem CID 139666855) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine.
| Compound Name | 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 139666855 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine |
| SMILES | c1ccc(N2CNc3ncccc32)cc1 |
| InChI | InChI=1S/C12H11N3/c1-2-5-10(6-3-1)15-9-14-12-11(15)7-4-8-13-12/h1-8H,9H2,(H,13,14) |
| InChIKey | DSKZKAYFGNSISV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |