About 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine
1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine (PubChem CID 139666855) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine |
| PubChem CID | 139666855 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine |
| SMILES | c1ccc(N2CNc3ncccc32)cc1 |
| InChI | InChI=1S/C12H11N3/c1-2-5-10(6-3-1)15-9-14-12-11(15)7-4-8-13-12/h1-8H,9H2,(H,13,14) |
| InChIKey | DSKZKAYFGNSISV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine?
The IUPAC name of 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine (CID 139666855) is 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine.
What is the SMILES notation for 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine?
The canonical SMILES for 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine is c1ccc(N2CNc3ncccc32)cc1.
What is the InChIKey of 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine?
The InChIKey is DSKZKAYFGNSISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-2-5-10(6-3-1)15-9-14-12-11(15)7-4-8-13-12/h1-8H,9H2,(H,13,14).
What are the key properties of 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine?
1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine has a molecular weight of 197.24 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2,3-dihydroimidazo[4,5-b]pyridine is sourced from PubChem (CID 139666855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).