About 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one
1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 152678723) has the molecular formula C7H6BrN3O
and a molecular weight of 228.05 g/mol. Its IUPAC name is 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one |
| PubChem CID | 152678723 |
| Molecular Formula | C7H6BrN3O |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | O=C1CNc2ncccc2N1Br |
| InChI | InChI=1S/C7H6BrN3O/c8-11-5-2-1-3-9-7(5)10-4-6(11)12/h1-3H,4H2,(H,9,10) |
| InChIKey | ZNBKITUABFFIIF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one?
The IUPAC name of 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one (CID 152678723) is 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one.
What is the SMILES notation for 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one?
The canonical SMILES for 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one is O=C1CNc2ncccc2N1Br.
What is the InChIKey of 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one?
The InChIKey is ZNBKITUABFFIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3O/c8-11-5-2-1-3-9-7(5)10-4-6(11)12/h1-3H,4H2,(H,9,10).
What are the key properties of 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one?
1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one has a molecular weight of 228.05 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,4-dihydropyrido[2,3-b]pyrazin-2-one is sourced from PubChem (CID 152678723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).