C8H7N2O2- — CID 87723963
1-oxido-3,4-dihydroquinoxalin-2-one (PubChem CID 87723963) has the molecular formula C8H7N2O2- and a molecular weight of 163.16 g/mol. Its IUPAC name is 1-oxido-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-oxido-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 87723963 |
| Molecular Formula | C8H7N2O2- |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 1-oxido-3,4-dihydroquinoxalin-2-one |
| SMILES | O=C1CNc2ccccc2N1[O-] |
| InChI | InChI=1S/C8H7N2O2/c11-8-5-9-6-3-1-2-4-7(6)10(8)12/h1-4,9H,5H2/q-1 |
| InChIKey | QVXKUSQTWBUFQP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |