C14H13N3O — CID 117030560
1-(3-aminophenyl)-3,4-dihydroquinoxalin-2-one (PubChem CID 117030560) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-(3-aminophenyl)-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 117030560 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(3-aminophenyl)-3,4-dihydroquinoxalin-2-one |
| SMILES | Nc1cccc(N2C(=O)CNc3ccccc32)c1 |
| InChI | InChI=1S/C14H13N3O/c15-10-4-3-5-11(8-10)17-13-7-2-1-6-12(13)16-9-14(17)18/h1-8,16H,9,15H2 |
| InChIKey | ZNYRLZBIOGXFSZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|