C14H11ClN2O — CID 117006502
1-(2-chlorophenyl)-3,4-dihydroquinoxalin-2-one (PubChem CID 117006502) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-(2-chlorophenyl)-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 117006502 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3,4-dihydroquinoxalin-2-one |
| SMILES | O=C1CNc2ccccc2N1c1ccccc1Cl |
| InChI | InChI=1S/C14H11ClN2O/c15-10-5-1-3-7-12(10)17-13-8-4-2-6-11(13)16-9-14(17)18/h1-8,16H,9H2 |
| InChIKey | DTJWPDCGKPSYDM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |