C12H14N2O — CID 82156911
1-(2-methylprop-2-enyl)-3,4-dihydroquinoxalin-2-one (PubChem CID 82156911) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3,4-dihydroquinoxalin-2-one.
| Compound Name | 1-(2-methylprop-2-enyl)-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 82156911 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3,4-dihydroquinoxalin-2-one |
| SMILES | C=C(C)CN1C(=O)CNc2ccccc21 |
| InChI | InChI=1S/C12H14N2O/c1-9(2)8-14-11-6-4-3-5-10(11)13-7-12(14)15/h3-6,13H,1,7-8H2,2H3 |
| InChIKey | WXUGEQDUBGDXRA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|