C12H13N3O — CID 62876473
4-(2-oxo-3,4-dihydroquinoxalin-1-yl)butanenitrile (PubChem CID 62876473) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-(2-oxo-3,4-dihydroquinoxalin-1-yl)butanenitrile.
| Compound Name | 4-(2-oxo-3,4-dihydroquinoxalin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 62876473 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-(2-oxo-3,4-dihydroquinoxalin-1-yl)butanenitrile |
| SMILES | N#CCCCN1C(=O)CNc2ccccc21 |
| InChI | InChI=1S/C12H13N3O/c13-7-3-4-8-15-11-6-2-1-5-10(11)14-9-12(15)16/h1-2,5-6,14H,3-4,8-9H2 |
| InChIKey | VNGQCYVVBOTLMX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|