C13H15N3O — CID 117007007
4-butyl-3-oxo-1,2-dihydroquinoxaline-6-carbonitrile (PubChem CID 117007007) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-butyl-3-oxo-1,2-dihydroquinoxaline-6-carbonitrile.
| Compound Name | 4-butyl-3-oxo-1,2-dihydroquinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 117007007 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-butyl-3-oxo-1,2-dihydroquinoxaline-6-carbonitrile |
| SMILES | CCCCN1C(=O)CNc2ccc(C#N)cc21 |
| InChI | InChI=1S/C13H15N3O/c1-2-3-6-16-12-7-10(8-14)4-5-11(12)15-9-13(16)17/h4-5,7,15H,2-3,6,9H2,1H3 |
| InChIKey | RBPUDCAJKQNQFC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |