About 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile
2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile (PubChem CID 117031304) has the molecular formula C10H6N4O
and a molecular weight of 198.19 g/mol. Its IUPAC name is 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile.
Molecular Properties
| Compound Name | 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile |
| PubChem CID | 117031304 |
| Molecular Formula | C10H6N4O |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)N(C#N)C(=O)CN2 |
| InChI | InChI=1S/C10H6N4O/c11-4-7-1-2-8-9(3-7)14(6-12)10(15)5-13-8/h1-3,13H,5H2 |
| InChIKey | UBXXESNBFUCVDD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile?
The IUPAC name of 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile (CID 117031304) is 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile.
What is the SMILES notation for 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile?
The canonical SMILES for 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile is N#Cc1ccc2c(c1)N(C#N)C(=O)CN2.
What is the InChIKey of 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile?
The InChIKey is UBXXESNBFUCVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4O/c11-4-7-1-2-8-9(3-7)14(6-12)10(15)5-13-8/h1-3,13H,5H2.
What are the key properties of 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile?
2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile has a molecular weight of 198.19 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile is sourced from PubChem (CID 117031304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).