C10H6N4O — CID 117031304
2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile (PubChem CID 117031304) has the molecular formula C10H6N4O and a molecular weight of 198.19 g/mol. Its IUPAC name is 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile.
| Compound Name | 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 117031304 |
| Molecular Formula | C10H6N4O |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-oxo-3,4-dihydroquinoxaline-1,7-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)N(C#N)C(=O)CN2 |
| InChI | InChI=1S/C10H6N4O/c11-4-7-1-2-8-9(3-7)14(6-12)10(15)5-13-8/h1-3,13H,5H2 |
| InChIKey | UBXXESNBFUCVDD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|