C14H19N3 — CID 115311358
5-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)pentanenitrile (PubChem CID 115311358) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 5-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)pentanenitrile.
| Compound Name | 5-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)pentanenitrile |
|---|---|
| PubChem CID | 115311358 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)pentanenitrile |
| SMILES | N#CCCCCN1CCCNc2ccccc21 |
| InChI | InChI=1S/C14H19N3/c15-9-4-1-5-11-17-12-6-10-16-13-7-2-3-8-14(13)17/h2-3,7-8,16H,1,4-6,10-12H2 |
| InChIKey | LFBINKFJRGKKLS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|