C10H12F2N2 — CID 60922941
4-(2,2-difluoroethyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 60922941) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-(2,2-difluoroethyl)-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 60922941 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-(2,2-difluoroethyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | FC(F)CN1CCNc2ccccc21 |
| InChI | InChI=1S/C10H12F2N2/c11-10(12)7-14-6-5-13-8-3-1-2-4-9(8)14/h1-4,10,13H,5-7H2 |
| InChIKey | UUHKQMQHWAMBLI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |