About 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline
4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 106453436) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 106453436 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | CCCOCCN1CCNc2ccccc21 |
| InChI | InChI=1S/C13H20N2O/c1-2-10-16-11-9-15-8-7-14-12-5-3-4-6-13(12)15/h3-6,14H,2,7-11H2,1H3 |
| InChIKey | SJKGLNXOKNGYED-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline (CID 106453436) is 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline is CCCOCCN1CCNc2ccccc21.
What is the InChIKey of 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline?
The InChIKey is SJKGLNXOKNGYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-2-10-16-11-9-15-8-7-14-12-5-3-4-6-13(12)15/h3-6,14H,2,7-11H2,1H3.
What are the key properties of 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline?
4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline has a molecular weight of 220.32 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-propoxyethyl)-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 106453436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).