C14H22N2O2 — CID 103180257
4-[2-(3-methoxypropoxy)ethyl]-2,3-dihydro-1H-quinoxaline (PubChem CID 103180257) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-[2-(3-methoxypropoxy)ethyl]-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-[2-(3-methoxypropoxy)ethyl]-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 103180257 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-[2-(3-methoxypropoxy)ethyl]-2,3-dihydro-1H-quinoxaline |
| SMILES | COCCCOCCN1CCNc2ccccc21 |
| InChI | InChI=1S/C14H22N2O2/c1-17-10-4-11-18-12-9-16-8-7-15-13-5-2-3-6-14(13)16/h2-3,5-6,15H,4,7-12H2,1H3 |
| InChIKey | VWDZBOOSIDXQDI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|