C9H7ClN2O2 — CID 83813700
1-(2-chloro-3-pyridinyl)pyrrolidine-2,5-dione (PubChem CID 83813700) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2-chloro-3-pyridinyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 83813700 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cccnc1Cl |
| InChI | InChI=1S/C9H7ClN2O2/c10-9-6(2-1-5-11-9)12-7(13)3-4-8(12)14/h1-2,5H,3-4H2 |
| InChIKey | AYQMVYCEIGCRJE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|