C14H11ClN2O — CID 132609221
6-chloro-1-pyridin-2-yl-3,4-dihydroquinolin-2-one (PubChem CID 132609221) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 6-chloro-1-pyridin-2-yl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-chloro-1-pyridin-2-yl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 132609221 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 6-chloro-1-pyridin-2-yl-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2cc(Cl)ccc2N1c1ccccn1 |
| InChI | InChI=1S/C14H11ClN2O/c15-11-5-6-12-10(9-11)4-7-14(18)17(12)13-3-1-2-8-16-13/h1-3,5-6,8-9H,4,7H2 |
| InChIKey | DHUKLBROWWBSDD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |