About 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione
3-pyridin-2-yl-1,3-oxazolidine-2,4-dione (PubChem CID 130058085) has the molecular formula C8H6N2O3
and a molecular weight of 178.15 g/mol. Its IUPAC name is 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 130058085 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1COC(=O)N1c1ccccn1 |
| InChI | InChI=1S/C8H6N2O3/c11-7-5-13-8(12)10(7)6-3-1-2-4-9-6/h1-4H,5H2 |
| InChIKey | GMICTXABIWYWRC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione (CID 130058085) is 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione is O=C1COC(=O)N1c1ccccn1.
What is the InChIKey of 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione?
The InChIKey is GMICTXABIWYWRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3/c11-7-5-13-8(12)10(7)6-3-1-2-4-9-6/h1-4H,5H2.
What are the key properties of 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione?
3-pyridin-2-yl-1,3-oxazolidine-2,4-dione has a molecular weight of 178.15 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 130058085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).