C9H10N2O2 — CID 102338604
5-methyl-3-pyridin-2-yl-1,3-oxazolidin-2-one (PubChem CID 102338604) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-methyl-3-pyridin-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 5-methyl-3-pyridin-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102338604 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 5-methyl-3-pyridin-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC1CN(c2ccccn2)C(=O)O1 |
| InChI | InChI=1S/C9H10N2O2/c1-7-6-11(9(12)13-7)8-4-2-3-5-10-8/h2-5,7H,6H2,1H3 |
| InChIKey | QBHNLANVKMHNLL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |