About (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide
(2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide (PubChem CID 140997050) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide.
Molecular Properties
| Compound Name | (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide |
| PubChem CID | 140997050 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide |
| SMILES | CC1CN(c2ccccn2)[S@@](=O)O1 |
| InChI | InChI=1S/C8H10N2O2S/c1-7-6-10(13(11)12-7)8-4-2-3-5-9-8/h2-5,7H,6H2,1H3/t7?,13-/m0/s1 |
| InChIKey | VCSJKECEKPOKKY-GRSHUZJTSA-N |
| XLogP | 0.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide?
The IUPAC name of (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide (CID 140997050) is (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide.
What is the SMILES notation for (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide?
The canonical SMILES for (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide is CC1CN(c2ccccn2)[S@@](=O)O1.
What is the InChIKey of (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide?
The InChIKey is VCSJKECEKPOKKY-GRSHUZJTSA-N. The full InChI is InChI=1S/C8H10N2O2S/c1-7-6-10(13(11)12-7)8-4-2-3-5-9-8/h2-5,7H,6H2,1H3/t7?,13-/m0/s1.
What are the key properties of (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide?
(2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide has a molecular weight of 198.25 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-methyl-3-pyridin-2-yloxathiazolidine 2-oxide is sourced from PubChem (CID 140997050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).