C15H12N2O3 — CID 172746024
1'-pyridin-2-ylspiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 172746024) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1'-pyridin-2-ylspiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 1'-pyridin-2-ylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 172746024 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1'-pyridin-2-ylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | O=C1N(c2ccccn2)c2ccccc2C12OCCO2 |
| InChI | InChI=1S/C15H12N2O3/c18-14-15(19-9-10-20-15)11-5-1-2-6-12(11)17(14)13-7-3-4-8-16-13/h1-8H,9-10H2 |
| InChIKey | JSRIHKBEIOMDGL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |