C14H13ClN2 — CID 62470174
1-[(2-chloro-3-pyridinyl)methyl]-2,3-dihydroindole (PubChem CID 62470174) has the molecular formula C14H13ClN2 and a molecular weight of 244.73 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)methyl]-2,3-dihydroindole.
| Compound Name | 1-[(2-chloro-3-pyridinyl)methyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 62470174 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)methyl]-2,3-dihydroindole |
| SMILES | Clc1ncccc1CN1CCc2ccccc21 |
| InChI | InChI=1S/C14H13ClN2/c15-14-12(5-3-8-16-14)10-17-9-7-11-4-1-2-6-13(11)17/h1-6,8H,7,9-10H2 |
| InChIKey | DSNYCFMHWXMVHS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|