C16H17Cl2N3 — CID 75422316
7-chloro-5-[(2-chloro-3-pyridinyl)methyl]-1-methyl-3,4-dihydro-2H-1,5-benzodiazepine (PubChem CID 75422316) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 7-chloro-5-[(2-chloro-3-pyridinyl)methyl]-1-methyl-3,4-dihydro-2H-1,5-benzodiazepine.
| Compound Name | 7-chloro-5-[(2-chloro-3-pyridinyl)methyl]-1-methyl-3,4-dihydro-2H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 75422316 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 7-chloro-5-[(2-chloro-3-pyridinyl)methyl]-1-methyl-3,4-dihydro-2H-1,5-benzodiazepine |
| SMILES | CN1CCCN(Cc2cccnc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H17Cl2N3/c1-20-8-3-9-21(11-12-4-2-7-19-16(12)18)15-10-13(17)5-6-14(15)20/h2,4-7,10H,3,8-9,11H2,1H3 |
| InChIKey | WWZXODSUIDGJGL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|