C18H15ClN2 — CID 60669763
2-chloro-3-(2,3-dihydroindol-1-ylmethyl)quinoline (PubChem CID 60669763) has the molecular formula C18H15ClN2 and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-chloro-3-(2,3-dihydroindol-1-ylmethyl)quinoline.
| Compound Name | 2-chloro-3-(2,3-dihydroindol-1-ylmethyl)quinoline |
|---|---|
| PubChem CID | 60669763 |
| Molecular Formula | C18H15ClN2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-chloro-3-(2,3-dihydroindol-1-ylmethyl)quinoline |
| SMILES | Clc1nc2ccccc2cc1CN1CCc2ccccc21 |
| InChI | InChI=1S/C18H15ClN2/c19-18-15(11-14-6-1-3-7-16(14)20-18)12-21-10-9-13-5-2-4-8-17(13)21/h1-8,11H,9-10,12H2 |
| InChIKey | PWSFMIJLGGBSAI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|