C18H17N3 — CID 115485710
2-(2,3-dihydroindol-1-ylmethyl)quinolin-4-amine (PubChem CID 115485710) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-ylmethyl)quinolin-4-amine.
| Compound Name | 2-(2,3-dihydroindol-1-ylmethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 115485710 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(2,3-dihydroindol-1-ylmethyl)quinolin-4-amine |
| SMILES | Nc1cc(CN2CCc3ccccc32)nc2ccccc12 |
| InChI | InChI=1S/C18H17N3/c19-16-11-14(20-17-7-3-2-6-15(16)17)12-21-10-9-13-5-1-4-8-18(13)21/h1-8,11H,9-10,12H2,(H2,19,20) |
| InChIKey | CIPWJUKLVZNCMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |