C16H21N3S — CID 115485907
2-[(2,6-dimethylthiomorpholin-4-yl)methyl]quinolin-4-amine (PubChem CID 115485907) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[(2,6-dimethylthiomorpholin-4-yl)methyl]quinolin-4-amine.
| Compound Name | 2-[(2,6-dimethylthiomorpholin-4-yl)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 115485907 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[(2,6-dimethylthiomorpholin-4-yl)methyl]quinolin-4-amine |
| SMILES | CC1CN(Cc2cc(N)c3ccccc3n2)CC(C)S1 |
| InChI | InChI=1S/C16H21N3S/c1-11-8-19(9-12(2)20-11)10-13-7-15(17)14-5-3-4-6-16(14)18-13/h3-7,11-12H,8-10H2,1-2H3,(H2,17,18) |
| InChIKey | ZETSVAGCMUWDHM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |