C18H25N3 — CID 114593810
2-[(2,3,5-trimethylpiperidin-1-yl)methyl]quinolin-4-amine (PubChem CID 114593810) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-[(2,3,5-trimethylpiperidin-1-yl)methyl]quinolin-4-amine.
| Compound Name | 2-[(2,3,5-trimethylpiperidin-1-yl)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 114593810 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-[(2,3,5-trimethylpiperidin-1-yl)methyl]quinolin-4-amine |
| SMILES | CC1CC(C)C(C)N(Cc2cc(N)c3ccccc3n2)C1 |
| InChI | InChI=1S/C18H25N3/c1-12-8-13(2)14(3)21(10-12)11-15-9-17(19)16-6-4-5-7-18(16)20-15/h4-7,9,12-14H,8,10-11H2,1-3H3,(H2,19,20) |
| InChIKey | YOPBHGMPRGIGLU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |