C11H9N3O — CID 96620714
2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-3-carbaldehyde (PubChem CID 96620714) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-3-carbaldehyde.
| Compound Name | 2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-3-carbaldehyde |
|---|---|
| PubChem CID | 96620714 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-3-carbaldehyde |
| SMILES | O=Cc1ccc2n1-c1cccnc1NC2 |
| InChI | InChI=1S/C11H9N3O/c15-7-9-4-3-8-6-13-11-10(14(8)9)2-1-5-12-11/h1-5,7H,6H2,(H,12,13) |
| InChIKey | FCCGEAISAJCCLQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|