About [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+)
[(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) (PubChem CID 170788982) has the molecular formula C7H8N3ORb
and a molecular weight of 235.63 g/mol. Its IUPAC name is [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+).
Molecular Properties
| Compound Name | [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) |
| PubChem CID | 170788982 |
| Molecular Formula | C7H8N3ORb |
| Molecular Weight | 235.63 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) |
| SMILES | C[N-]Nc1ncccc1C=O.[Rb+] |
| InChI | InChI=1S/C7H8N3O.Rb/c1-8-10-7-6(5-11)3-2-4-9-7;/h2-5H,1H3,(H,9,10,11);/q-1;+1 |
| InChIKey | GZLMRLLRYVKDPQ-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.63 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+)?
The IUPAC name of [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) (CID 170788982) is [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+).
What is the SMILES notation for [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+)?
The canonical SMILES for [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) is C[N-]Nc1ncccc1C=O.[Rb+].
What is the InChIKey of [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+)?
The InChIKey is GZLMRLLRYVKDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3O.Rb/c1-8-10-7-6(5-11)3-2-4-9-7;/h2-5H,1H3,(H,9,10,11);/q-1;+1.
What are the key properties of [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+)?
[(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) has a molecular weight of 235.63 g/mol, XLogP of -1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-formyl-2-pyridinyl)amino]-methylazanide;rubidium(1+) is sourced from PubChem (CID 170788982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).