C13H11ClN2O2 — CID 118011803
2-(3-chloro-5-methoxyanilino)pyridine-3-carbaldehyde (PubChem CID 118011803) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-(3-chloro-5-methoxyanilino)pyridine-3-carbaldehyde.
| Compound Name | 2-(3-chloro-5-methoxyanilino)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 118011803 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(3-chloro-5-methoxyanilino)pyridine-3-carbaldehyde |
| SMILES | COc1cc(Cl)cc(Nc2ncccc2C=O)c1 |
| InChI | InChI=1S/C13H11ClN2O2/c1-18-12-6-10(14)5-11(7-12)16-13-9(8-17)3-2-4-15-13/h2-8H,1H3,(H,15,16) |
| InChIKey | RURYOLVGLVVICW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|