C13H15N3O — CID 143052286
benzene-1,4-diamine;2-methylpyridine-3-carbaldehyde (PubChem CID 143052286) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is benzene-1,4-diamine;2-methylpyridine-3-carbaldehyde.
| Compound Name | benzene-1,4-diamine;2-methylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 143052286 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | benzene-1,4-diamine;2-methylpyridine-3-carbaldehyde |
| SMILES | Cc1ncccc1C=O.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C7H7NO.C6H8N2/c1-6-7(5-9)3-2-4-8-6;7-5-1-2-6(8)4-3-5/h2-5H,1H3;1-4H,7-8H2 |
| InChIKey | JGPOEQIFRKJAOL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|