carbon dioxide;2-methylpyridin-3-amine

C7H8N2O2 — CID 157100546

IUPACcarbon dioxide;2-methylpyridin-3-amine
SMILESCc1ncccc1N.O=C=O
InChIInChI=1S/C6H8N2.CO2/c1-5-6(7)3-2-4-8-5;2-1-3/h2-4H,7H2,1H3;
InChIKeyAFSFPFSFONCUDE-UHFFFAOYSA-N
MW152.15 g/mol
LogP0.39
Rot. Bonds

About carbon dioxide;2-methylpyridin-3-amine

carbon dioxide;2-methylpyridin-3-amine (PubChem CID 157100546) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is carbon dioxide;2-methylpyridin-3-amine.

Molecular Properties

Compound Namecarbon dioxide;2-methylpyridin-3-amine
PubChem CID157100546
Molecular FormulaC7H8N2O2
Molecular Weight152.15 g/mol
Exact Mass152.06
IUPAC Namecarbon dioxide;2-methylpyridin-3-amine
SMILESCc1ncccc1N.O=C=O
InChIInChI=1S/C6H8N2.CO2/c1-5-6(7)3-2-4-8-5;2-1-3/h2-4H,7H2,1H3;
InChIKeyAFSFPFSFONCUDE-UHFFFAOYSA-N
XLogP0.39
TPSA73.05 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.15
LogP ≤ 50.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze carbon dioxide;2-methylpyridin-3-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;2-methylpyridin-3-amine?
The IUPAC name of carbon dioxide;2-methylpyridin-3-amine (CID 157100546) is carbon dioxide;2-methylpyridin-3-amine.
What is the SMILES notation for carbon dioxide;2-methylpyridin-3-amine?
The canonical SMILES for carbon dioxide;2-methylpyridin-3-amine is Cc1ncccc1N.O=C=O.
What is the InChIKey of carbon dioxide;2-methylpyridin-3-amine?
The InChIKey is AFSFPFSFONCUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.CO2/c1-5-6(7)3-2-4-8-5;2-1-3/h2-4H,7H2,1H3;.
What are the key properties of carbon dioxide;2-methylpyridin-3-amine?
carbon dioxide;2-methylpyridin-3-amine has a molecular weight of 152.15 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-methylpyridin-3-amine is sourced from PubChem (CID 157100546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).