About carbon dioxide;2-methylpyridin-3-amine
carbon dioxide;2-methylpyridin-3-amine (PubChem CID 157100546) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is carbon dioxide;2-methylpyridin-3-amine.
Molecular Properties
| Compound Name | carbon dioxide;2-methylpyridin-3-amine |
| PubChem CID | 157100546 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | carbon dioxide;2-methylpyridin-3-amine |
| SMILES | Cc1ncccc1N.O=C=O |
| InChI | InChI=1S/C6H8N2.CO2/c1-5-6(7)3-2-4-8-5;2-1-3/h2-4H,7H2,1H3; |
| InChIKey | AFSFPFSFONCUDE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;2-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-methylpyridin-3-amine?
The IUPAC name of carbon dioxide;2-methylpyridin-3-amine (CID 157100546) is carbon dioxide;2-methylpyridin-3-amine.
What is the SMILES notation for carbon dioxide;2-methylpyridin-3-amine?
The canonical SMILES for carbon dioxide;2-methylpyridin-3-amine is Cc1ncccc1N.O=C=O.
What is the InChIKey of carbon dioxide;2-methylpyridin-3-amine?
The InChIKey is AFSFPFSFONCUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.CO2/c1-5-6(7)3-2-4-8-5;2-1-3/h2-4H,7H2,1H3;.
What are the key properties of carbon dioxide;2-methylpyridin-3-amine?
carbon dioxide;2-methylpyridin-3-amine has a molecular weight of 152.15 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-methylpyridin-3-amine is sourced from PubChem (CID 157100546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).