C8H14N2O2 — CID 175110807
2,3-dimethylpyridine;formamide;hydrate (PubChem CID 175110807) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2,3-dimethylpyridine;formamide;hydrate.
| Compound Name | 2,3-dimethylpyridine;formamide;hydrate |
|---|---|
| PubChem CID | 175110807 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2,3-dimethylpyridine;formamide;hydrate |
| SMILES | Cc1cccnc1C.NC=O.O |
| InChI | InChI=1S/C7H9N.CH3NO.H2O/c1-6-4-3-5-8-7(6)2;2-1-3;/h3-5H,1-2H3;1H,(H2,2,3);1H2 |
| InChIKey | SADWLFKDKMWSMZ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|