About 2-methylpyridin-3-amine;hydroiodide
2-methylpyridin-3-amine;hydroiodide (PubChem CID 172837374) has the molecular formula C6H9IN2
and a molecular weight of 236.06 g/mol. Its IUPAC name is 2-methylpyridin-3-amine;hydroiodide.
Molecular Properties
| Compound Name | 2-methylpyridin-3-amine;hydroiodide |
| PubChem CID | 172837374 |
| Molecular Formula | C6H9IN2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 2-methylpyridin-3-amine;hydroiodide |
| SMILES | Cc1ncccc1N.I |
| InChI | InChI=1S/C6H8N2.HI/c1-5-6(7)3-2-4-8-5;/h2-4H,7H2,1H3;1H |
| InChIKey | WIGUUVTYPPXIJM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpyridin-3-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyridin-3-amine;hydroiodide?
The IUPAC name of 2-methylpyridin-3-amine;hydroiodide (CID 172837374) is 2-methylpyridin-3-amine;hydroiodide.
What is the SMILES notation for 2-methylpyridin-3-amine;hydroiodide?
The canonical SMILES for 2-methylpyridin-3-amine;hydroiodide is Cc1ncccc1N.I.
What is the InChIKey of 2-methylpyridin-3-amine;hydroiodide?
The InChIKey is WIGUUVTYPPXIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.HI/c1-5-6(7)3-2-4-8-5;/h2-4H,7H2,1H3;1H.
What are the key properties of 2-methylpyridin-3-amine;hydroiodide?
2-methylpyridin-3-amine;hydroiodide has a molecular weight of 236.06 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyridin-3-amine;hydroiodide is sourced from PubChem (CID 172837374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).