About 2-chloropyridin-3-amine;ethane
2-chloropyridin-3-amine;ethane (PubChem CID 91236082) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 2-chloropyridin-3-amine;ethane.
Molecular Properties
| Compound Name | 2-chloropyridin-3-amine;ethane |
| PubChem CID | 91236082 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-chloropyridin-3-amine;ethane |
| SMILES | CC.Nc1cccnc1Cl |
| InChI | InChI=1S/C5H5ClN2.C2H6/c6-5-4(7)2-1-3-8-5;1-2/h1-3H,7H2;1-2H3 |
| InChIKey | FMXFJAGYDNKBFC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyridin-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridin-3-amine;ethane?
The IUPAC name of 2-chloropyridin-3-amine;ethane (CID 91236082) is 2-chloropyridin-3-amine;ethane.
What is the SMILES notation for 2-chloropyridin-3-amine;ethane?
The canonical SMILES for 2-chloropyridin-3-amine;ethane is CC.Nc1cccnc1Cl.
What is the InChIKey of 2-chloropyridin-3-amine;ethane?
The InChIKey is FMXFJAGYDNKBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2.C2H6/c6-5-4(7)2-1-3-8-5;1-2/h1-3H,7H2;1-2H3.
What are the key properties of 2-chloropyridin-3-amine;ethane?
2-chloropyridin-3-amine;ethane has a molecular weight of 158.63 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridin-3-amine;ethane is sourced from PubChem (CID 91236082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).