About 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one
2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one (PubChem CID 158738770) has the molecular formula C16H22Cl2N4O
and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one.
Molecular Properties
| Compound Name | 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one |
| PubChem CID | 158738770 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one |
| SMILES | CC(C)=O.CC(C)Nc1cccnc1Cl.Nc1cccnc1Cl |
| InChI | InChI=1S/C8H11ClN2.C5H5ClN2.C3H6O/c1-6(2)11-7-4-3-5-10-8(7)9;6-5-4(7)2-1-3-8-5;1-3(2)4/h3-6,11H,1-2H3;1-3H,7H2;1-2H3 |
| InChIKey | IMACCOYPBHMMNX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one?
The IUPAC name of 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one (CID 158738770) is 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one.
What is the SMILES notation for 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one?
The canonical SMILES for 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one is CC(C)=O.CC(C)Nc1cccnc1Cl.Nc1cccnc1Cl.
What is the InChIKey of 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one?
The InChIKey is IMACCOYPBHMMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2.C5H5ClN2.C3H6O/c1-6(2)11-7-4-3-5-10-8(7)9;6-5-4(7)2-1-3-8-5;1-3(2)4/h3-6,11H,1-2H3;1-3H,7H2;1-2H3.
What are the key properties of 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one?
2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one has a molecular weight of 357.29 g/mol, XLogP of 4.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-propan-2-ylpyridin-3-amine;2-chloropyridin-3-amine;propan-2-one is sourced from PubChem (CID 158738770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).