C15H19N — CID 174745079
2,3-dimethylpyridine;1,4-xylene (PubChem CID 174745079) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,3-dimethylpyridine;1,4-xylene.
| Compound Name | 2,3-dimethylpyridine;1,4-xylene |
|---|---|
| PubChem CID | 174745079 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,3-dimethylpyridine;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1cccnc1C |
| InChI | InChI=1S/C8H10.C7H9N/c1-7-3-5-8(2)6-4-7;1-6-4-3-5-8-7(6)2/h3-6H,1-2H3;3-5H,1-2H3 |
| InChIKey | TUEHKWGIDQMQFR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |