About 2,3-dimethylpyridine;1,4-xylene
2,3-dimethylpyridine;1,4-xylene (PubChem CID 174745079) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,3-dimethylpyridine;1,4-xylene.
Molecular Properties
| Compound Name | 2,3-dimethylpyridine;1,4-xylene |
| PubChem CID | 174745079 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,3-dimethylpyridine;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.Cc1cccnc1C |
| InChI | InChI=1S/C8H10.C7H9N/c1-7-3-5-8(2)6-4-7;1-6-4-3-5-8-7(6)2/h3-6H,1-2H3;3-5H,1-2H3 |
| InChIKey | TUEHKWGIDQMQFR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylpyridine;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpyridine;1,4-xylene?
The IUPAC name of 2,3-dimethylpyridine;1,4-xylene (CID 174745079) is 2,3-dimethylpyridine;1,4-xylene.
What is the SMILES notation for 2,3-dimethylpyridine;1,4-xylene?
The canonical SMILES for 2,3-dimethylpyridine;1,4-xylene is Cc1ccc(C)cc1.Cc1cccnc1C.
What is the InChIKey of 2,3-dimethylpyridine;1,4-xylene?
The InChIKey is TUEHKWGIDQMQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C7H9N/c1-7-3-5-8(2)6-4-7;1-6-4-3-5-8-7(6)2/h3-6H,1-2H3;3-5H,1-2H3.
What are the key properties of 2,3-dimethylpyridine;1,4-xylene?
2,3-dimethylpyridine;1,4-xylene has a molecular weight of 213.32 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpyridine;1,4-xylene is sourced from PubChem (CID 174745079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).