C15H27N — CID 145249818
buta-1,3-diene;2,3-dimethylpyridine;ethane (PubChem CID 145249818) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is buta-1,3-diene;2,3-dimethylpyridine;ethane.
| Compound Name | buta-1,3-diene;2,3-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 145249818 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | buta-1,3-diene;2,3-dimethylpyridine;ethane |
| SMILES | C=CC=C.CC.CC.Cc1cccnc1C |
| InChI | InChI=1S/C7H9N.C4H6.2C2H6/c1-6-4-3-5-8-7(6)2;1-3-4-2;2*1-2/h3-5H,1-2H3;3-4H,1-2H2;2*1-2H3 |
| InChIKey | QNFTXUCZIDWJHO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|