About 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine
3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine (PubChem CID 167164381) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine.
Molecular Properties
| Compound Name | 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine |
| PubChem CID | 167164381 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine |
| SMILES | C=C/C=C(\C)C(C)(C)c1cccnc1C |
| InChI | InChI=1S/C14H19N/c1-6-8-11(2)14(4,5)13-9-7-10-15-12(13)3/h6-10H,1H2,2-5H3/b11-8+ |
| InChIKey | QZYXGHOOEXRERQ-DHZHZOJOSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine?
The IUPAC name of 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine (CID 167164381) is 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine.
What is the SMILES notation for 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine?
The canonical SMILES for 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine is C=C/C=C(\C)C(C)(C)c1cccnc1C.
What is the InChIKey of 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine?
The InChIKey is QZYXGHOOEXRERQ-DHZHZOJOSA-N. The full InChI is InChI=1S/C14H19N/c1-6-8-11(2)14(4,5)13-9-7-10-15-12(13)3/h6-10H,1H2,2-5H3/b11-8+.
What are the key properties of 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine?
3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine has a molecular weight of 201.31 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-2,3-dimethylhexa-3,5-dien-2-yl]-2-methylpyridine is sourced from PubChem (CID 167164381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).