C13H18N2 — CID 163939008
N-[(3E)-2,2-dimethylhexa-3,5-dien-3-yl]pyridin-2-amine (PubChem CID 163939008) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[(3E)-2,2-dimethylhexa-3,5-dien-3-yl]pyridin-2-amine.
| Compound Name | N-[(3E)-2,2-dimethylhexa-3,5-dien-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 163939008 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-[(3E)-2,2-dimethylhexa-3,5-dien-3-yl]pyridin-2-amine |
| SMILES | C=C/C=C(/Nc1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C13H18N2/c1-5-8-11(13(2,3)4)15-12-9-6-7-10-14-12/h5-10H,1H2,2-4H3,(H,14,15)/b11-8+ |
| InChIKey | RPINXQNATORHJX-DHZHZOJOSA-N |
| XLogP | 3.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|