C8H9N5 — CID 131184068
1-(2-methyl-3-pyridinyl)-1,2,4-triazol-3-amine (PubChem CID 131184068) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(2-methyl-3-pyridinyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(2-methyl-3-pyridinyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 131184068 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1-(2-methyl-3-pyridinyl)-1,2,4-triazol-3-amine |
| SMILES | Cc1ncccc1-n1cnc(N)n1 |
| InChI | InChI=1S/C8H9N5/c1-6-7(3-2-4-10-6)13-5-11-8(9)12-13/h2-5H,1H3,(H2,9,12) |
| InChIKey | UCOPUUMAMHYMQV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |