C9H11N4+ — CID 123392680
2-methyl-3-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyridine (PubChem CID 123392680) has the molecular formula C9H11N4+ and a molecular weight of 175.21 g/mol. Its IUPAC name is 2-methyl-3-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyridine.
| Compound Name | 2-methyl-3-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyridine |
|---|---|
| PubChem CID | 123392680 |
| Molecular Formula | C9H11N4+ |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-methyl-3-(2-methyl-1,2,4-triazol-2-ium-1-yl)pyridine |
| SMILES | Cc1ncccc1-n1cnc[n+]1C |
| InChI | InChI=1S/C9H11N4/c1-8-9(4-3-5-11-8)13-7-10-6-12(13)2/h3-7H,1-2H3/q+1 |
| InChIKey | NWJFGCUNUUDBNZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|