C10H11N4+ — CID 123678019
1-methyl-2-(2-methyl-3-pyridinyl)-1,3,5-triazin-1-ium (PubChem CID 123678019) has the molecular formula C10H11N4+ and a molecular weight of 187.23 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-3-pyridinyl)-1,3,5-triazin-1-ium.
| Compound Name | 1-methyl-2-(2-methyl-3-pyridinyl)-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 123678019 |
| Molecular Formula | C10H11N4+ |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-methyl-2-(2-methyl-3-pyridinyl)-1,3,5-triazin-1-ium |
| SMILES | Cc1ncccc1-c1ncnc[n+]1C |
| InChI | InChI=1S/C10H11N4/c1-8-9(4-3-5-12-8)10-13-6-11-7-14(10)2/h3-7H,1-2H3/q+1 |
| InChIKey | YEHLWQPFHMLVRM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|