About 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride
1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride (PubChem CID 173235933) has the molecular formula C11H18Cl2N4
and a molecular weight of 277.20 g/mol. Its IUPAC name is 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride |
| PubChem CID | 173235933 |
| Molecular Formula | C11H18Cl2N4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cnc2c(c1)N(C1CCNCC1)CN2 |
| InChI | InChI=1S/C11H16N4.2ClH/c1-2-10-11(13-5-1)14-8-15(10)9-3-6-12-7-4-9;;/h1-2,5,9,12H,3-4,6-8H2,(H,13,14);2*1H |
| InChIKey | IGRBSNMWAWJRTM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride?
The IUPAC name of 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride (CID 173235933) is 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride.
What is the SMILES notation for 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride?
The canonical SMILES for 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride is Cl.Cl.c1cnc2c(c1)N(C1CCNCC1)CN2.
What is the InChIKey of 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride?
The InChIKey is IGRBSNMWAWJRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4.2ClH/c1-2-10-11(13-5-1)14-8-15(10)9-3-6-12-7-4-9;;/h1-2,5,9,12H,3-4,6-8H2,(H,13,14);2*1H.
What are the key properties of 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride?
1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride has a molecular weight of 277.20 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-2,3-dihydroimidazo[4,5-b]pyridine;dihydrochloride is sourced from PubChem (CID 173235933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).