C12H15ClN4O — CID 154878953
3-piperidin-4-ylpyrido[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 154878953) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 3-piperidin-4-ylpyrido[2,3-d]pyrimidin-4-one;hydrochloride.
| Compound Name | 3-piperidin-4-ylpyrido[2,3-d]pyrimidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 154878953 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-piperidin-4-ylpyrido[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | Cl.O=c1c2cccnc2ncn1C1CCNCC1 |
| InChI | InChI=1S/C12H14N4O.ClH/c17-12-10-2-1-5-14-11(10)15-8-16(12)9-3-6-13-7-4-9;/h1-2,5,8-9,13H,3-4,6-7H2;1H |
| InChIKey | NKQXEUFJPMGXHP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |