C8H10N4O — CID 160799180
3H-pyrrolo[3,2-b]pyridine;urea (PubChem CID 160799180) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 3H-pyrrolo[3,2-b]pyridine;urea.
| Compound Name | 3H-pyrrolo[3,2-b]pyridine;urea |
|---|---|
| PubChem CID | 160799180 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 3H-pyrrolo[3,2-b]pyridine;urea |
| SMILES | C1=Nc2cccnc2C1.NC(N)=O |
| InChI | InChI=1S/C7H6N2.CH4N2O/c1-2-6-7(8-4-1)3-5-9-6;2-1(3)4/h1-2,4-5H,3H2;(H4,2,3,4) |
| InChIKey | SCVJOBQRHDKUFT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |